CAS 2732320-70-4 appears in our catalog under these names: 1-Isopropyl-6-methoxyindoline-3,5-diol, 6-Methoxy-1-(propan-2-yl)-2,3-dihydro-1H-indole-3,5-diol. Offered by: TRC. Available pack sizes: 100mg.
6-methoxy-1-propan-2-yl-2,3-dihydroindole-3,5-diol (CAS 2732320-70-4) is a chemical compound with the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. IUPAC name: 6-methoxy-1-propan-2-yl-2,3-dihydroindole-3,5-diol. InChIKey: BNLGHOHOEIJWCJ-UHFFFAOYSA-N.
| Molecular formula | C12H17NO3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 6-methoxy-1-propan-2-yl-2,3-dihydroindole-3,5-diol |
| InChIKey | BNLGHOHOEIJWCJ-UHFFFAOYSA-N |
| SMILES | CC(C)N1CC(C2=CC(=C(C=C21)OC)O)O |
Computed by PubChem (NCBI)