Products 2732346-98-2
CAS 2732346-98-2 is the registry number for Dextropropoxyphene EP Impurity C (as Hydrochloride). Offered by: Mikromol. Available pack sizes: 25mg.
[(2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] butanoate;hydrochloride (CAS 2732346-98-2) is a chemical compound with the molecular formula C23H32ClNO2 and a molecular weight of 390.0 g/mol. IUPAC name: [(2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] butanoate;hydrochloride. InChIKey: OIYLYIRWDLPOMQ-GZAZMHIXSA-N.
| Molecular formula | C23H32ClNO2 |
|---|---|
| Molecular weight | 390.0 g/mol |
| IUPAC name | [(2S,3R)-4-(dimethylamino)-3-methyl-1,2-diphenylbutan-2-yl] butanoate;hydrochloride |
| InChIKey | OIYLYIRWDLPOMQ-GZAZMHIXSA-N |
| SMILES | CCCC(=O)O[C@](CC1=CC=CC=C1)(C2=CC=CC=C2)[C@H](C)CN(C)C.Cl |
Computed by PubChem (NCBI)