CAS 53757-35-0 is the registry number for (+)-alpha-Acetylmethadol Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
[(3R,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate;hydrochloride (CAS 53757-35-0) is a chemical compound with the molecular formula C23H32ClNO2 and a molecular weight of 390.0 g/mol. IUPAC name: [(3R,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate;hydrochloride. InChIKey: UXBPQRGCVJOTNT-TVNLMDKXSA-N.
| Molecular formula | C23H32ClNO2 |
|---|---|
| Molecular weight | 390.0 g/mol |
| IUPAC name | [(3R,6R)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate;hydrochloride |
| InChIKey | UXBPQRGCVJOTNT-TVNLMDKXSA-N |
| SMILES | CC[C@H](C(C[C@@H](C)N(C)C)(C1=CC=CC=C1)C2=CC=CC=C2)OC(=O)C.Cl |
Computed by PubChem (NCBI)