CAS 38821-43-1 appears in our catalog under these names: Acetylmethadol Hydrochloride (Mixture of Diastereomers) (1mg/ml in Acetonitrile), Acetylmethadol Hydrochloride (Mixture of Diastereomers), >95% (HPLC). Offered by: TRC. Available pack sizes: 10x1ml, 50mg.
(5-acetyloxy-4,4-diphenylheptan-2-yl)-dimethylazanium chloride (CAS 38821-43-1) is a chemical compound with the molecular formula C23H32ClNO2 and a molecular weight of 390.0 g/mol. IUPAC name: (5-acetyloxy-4,4-diphenylheptan-2-yl)-dimethylazanium chloride. InChIKey: UXBPQRGCVJOTNT-UHFFFAOYSA-N.
| Molecular formula | C23H32ClNO2 |
|---|---|
| Molecular weight | 390.0 g/mol |
| IUPAC name | (5-acetyloxy-4,4-diphenylheptan-2-yl)-dimethylazanium chloride |
| InChIKey | UXBPQRGCVJOTNT-UHFFFAOYSA-N |
| SMILES | CCC(C(CC(C)[NH+](C)C)(C1=CC=CC=C1)C2=CC=CC=C2)OC(=O)C.[Cl-] |
Computed by PubChem (NCBI)