CAS 61443-60-5 appears in our catalog under these names: Betacetylmethadol Hydrochloride, >95% (HPLC), Betacetylmethadol hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 25mg.
[(6R)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate;hydrochloride (CAS 61443-60-5) is a chemical compound with the molecular formula C23H32ClNO2 and a molecular weight of 390.0 g/mol. IUPAC name: [(6R)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate;hydrochloride. InChIKey: UXBPQRGCVJOTNT-PQMWQWLJSA-N.
| Molecular formula | C23H32ClNO2 |
|---|---|
| Molecular weight | 390.0 g/mol |
| IUPAC name | [(6R)-6-(dimethylamino)-4,4-diphenylheptan-3-yl] acetate;hydrochloride |
| InChIKey | UXBPQRGCVJOTNT-PQMWQWLJSA-N |
| SMILES | CCC(C(C[C@@H](C)N(C)C)(C1=CC=CC=C1)C2=CC=CC=C2)OC(=O)C.Cl |
Computed by PubChem (NCBI)