CAS 2732834-84-1 appears in our catalog under these names: Metobromuron D6 (methyl D3 methoxy D3) 100 µg/mL in Acetone, Metobromuron-d6 (methoxy-d3, N-methyl-d3), 99 atom % D, min 98% Chemical Purity. Offered by: Dr. Ehrenstorfer, CDN. Available pack sizes: 1ml, 0,01g, 0,005g.
3-(4-bromophenyl)-1-(trideuteriomethoxy)-1-(trideuteriomethyl)urea (CAS 2732834-84-1) is a chemical compound with the molecular formula C9H11BrN2O2 and a molecular weight of 265.14 g/mol. IUPAC name: 3-(4-bromophenyl)-1-(trideuteriomethoxy)-1-(trideuteriomethyl)urea. InChIKey: WLFDQEVORAMCIM-WFGJKAKNSA-N.
| Molecular formula | C9H11BrN2O2 |
|---|---|
| Molecular weight | 265.14 g/mol |
| IUPAC name | 3-(4-bromophenyl)-1-(trideuteriomethoxy)-1-(trideuteriomethyl)urea |
| InChIKey | WLFDQEVORAMCIM-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C(=O)NC1=CC=C(C=C1)Br)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)