Products 2732873-44-6
CAS 2732873-44-6 is the registry number for Chloroprocaine Hydrochloride-d4. Offered by: TRC. Available pack sizes: 25mg.
[1,1,2,2-tetradeuterio-2-(diethylamino)ethyl] 4-amino-2-chlorobenzoate;hydrochloride (CAS 2732873-44-6) is a chemical compound with the molecular formula C13H20Cl2N2O2 and a molecular weight of 311.24 g/mol. IUPAC name: [1,1,2,2-tetradeuterio-2-(diethylamino)ethyl] 4-amino-2-chlorobenzoate;hydrochloride. InChIKey: SZKQYDBPUCZLRX-UVSTZUAESA-N.
| Molecular formula | C13H20Cl2N2O2 |
|---|---|
| Molecular weight | 311.24 g/mol |
| IUPAC name | [1,1,2,2-tetradeuterio-2-(diethylamino)ethyl] 4-amino-2-chlorobenzoate;hydrochloride |
| InChIKey | SZKQYDBPUCZLRX-UVSTZUAESA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OC(=O)C1=C(C=C(C=C1)N)Cl)N(CC)CC.Cl |
Computed by PubChem (NCBI)
Synonyms:
Chloroprocaine Hydrochloride-d4