CAS 100811-81-2 appears in our catalog under these names: Proparacaine Impurity 15, Proparacaine Impurity 18 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-amino-4-chlorobenzoyl)oxyethyl-diethylazanium chloride (CAS 100811-81-2) is a chemical compound with the molecular formula C13H20Cl2N2O2 and a molecular weight of 307.21 g/mol. IUPAC name: 2-(3-amino-4-chlorobenzoyl)oxyethyl-diethylazanium chloride. InChIKey: CPOLGWZCPZLZOK-UHFFFAOYSA-N.
| Molecular formula | C13H20Cl2N2O2 |
|---|---|
| Molecular weight | 307.21 g/mol |
| IUPAC name | 2-(3-amino-4-chlorobenzoyl)oxyethyl-diethylazanium chloride |
| InChIKey | CPOLGWZCPZLZOK-UHFFFAOYSA-N |
| SMILES | CC[NH+](CC)CCOC(=O)C1=CC(=C(C=C1)Cl)N.[Cl-] |
Computed by PubChem (NCBI)