CAS 106261-49-8 appears in our catalog under these names: 4-[(4-Methylpiperazin-1-yl)methyl]benzoic acid dihydrochloride, 98%, 4-(4-Methylpiperazinomethyl)benzoic Acid, Dihydrochloride, >95% (HPLC), 4-((4-Methylpiperazin-1-yl)methyl)benzoic Acid Dihydrochloride, 4–((4–methylpiperazin–1–yl)methyl)benzoic acid dihydrochloride, 4-(4-Methylpiperazinomethyl)benzoic acid, dihydrochloride. Offered by: Combi-blocks, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, 1g, 2,5g, 25mg.
4-[(4-methylpiperazin-1-yl)methyl]benzoic acid;dihydrochloride (CAS 106261-49-8) is a chemical compound with the molecular formula C13H20Cl2N2O2 and a molecular weight of 307.21 g/mol. IUPAC name: 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid;dihydrochloride. InChIKey: ISHROKOWRJDOSN-UHFFFAOYSA-N.
| Molecular formula | C13H20Cl2N2O2 |
|---|---|
| Molecular weight | 307.21 g/mol |
| IUPAC name | 4-[(4-methylpiperazin-1-yl)methyl]benzoic acid;dihydrochloride |
| InChIKey | ISHROKOWRJDOSN-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)