Products 2733145-11-2
CAS 2733145-11-2 appears in our catalog under these names: Monolinuron D6 (methyl D3 methoxy D3) 100 µg/mL in Acetone, 3-(4-Chlorophenyl)-1-methoxy-1-methylurea-d6. Offered by: Dr. Ehrenstorfer, MedChemExpress. Available pack sizes: 1ml, 1mg, 5mg.
3-(4-chlorophenyl)-1-(trideuteriomethoxy)-1-(trideuteriomethyl)urea (CAS 2733145-11-2) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 220.68 g/mol. IUPAC name: 3-(4-chlorophenyl)-1-(trideuteriomethoxy)-1-(trideuteriomethyl)urea. InChIKey: LKJPSUCKSLORMF-WFGJKAKNSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 220.68 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1-(trideuteriomethoxy)-1-(trideuteriomethyl)urea |
| InChIKey | LKJPSUCKSLORMF-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N(C(=O)NC1=CC=C(C=C1)Cl)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)