Products 2733149-72-7
CAS 2733149-72-7 appears in our catalog under these names: (2–Fluoro–4–biphenyl)acetic acid–d5, (2-Fluoro-4-biphenyl)acetic acid-d5, 99%, 99%, (2-Fluoro-4-biphenyl)acetic acid-d5, 99.64%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 1 mg, 100 μg, 5 mg.
2-[3-fluoro-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]acetic acid (CAS 2733149-72-7) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 235.26 g/mol. IUPAC name: 2-[3-fluoro-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]acetic acid. InChIKey: ZLLZRKQQNGBXRD-RALIUCGRSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | 2-[3-fluoro-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]acetic acid |
| InChIKey | ZLLZRKQQNGBXRD-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C=C(C=C2)CC(=O)O)F)[2H])[2H] |
Computed by PubChem (NCBI)