Products 5001-96-7
CAS 5001-96-7 appears in our catalog under these names: 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid, 95%, 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid 97%, [1,1'-Biphenyl]-4-acetic acid, 2-fluoro-, 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 25mg.
2-(3-fluoro-4-phenylphenyl)acetic acid (CAS 5001-96-7) is a chemical compound with the molecular formula C14H11FO2 and a molecular weight of 230.23 g/mol. IUPAC name: 2-(3-fluoro-4-phenylphenyl)acetic acid. InChIKey: ZLLZRKQQNGBXRD-UHFFFAOYSA-N.
| Molecular formula | C14H11FO2 |
|---|---|
| Molecular weight | 230.23 g/mol |
| IUPAC name | 2-(3-fluoro-4-phenylphenyl)acetic acid |
| InChIKey | ZLLZRKQQNGBXRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)CC(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid, 2-(2-Fluoro-(1,1'-biphenyl)-4-yl)acetic acid, 2-{2-fluoro-[1,1'-biphenyl]-4-yl}acetic acid, (2-Fluoro-4-biphenyl)acetic Acid, 2-(3-fluoro-4-phenylphenyl)acetic acid, [1,1'-Biphenyl]-4-acetic acid, 2-fluoro-, Desmethylflurbiprofen, (2-Fluorobiphenyl-4-Yl)acetic Acid, 2-Fluorobiphenyl-4-acetic acid, Flurbiprofen Impurity 18