Products 2733271-85-5

CAS 2733271-85-5 is the registry number for 4-tert-Butylbenzoic-d13 Acid, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.

Structural formula: {0} (CAS {1})

2,3,5,6-tetradeuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]benzoic acid (CAS 2733271-85-5) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 191.31 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]benzoic acid. InChIKey: KDVYCTOWXSLNNI-JPLVHWSDSA-N.

Identity
Molecular formulaC11H14O2
Molecular weight191.31 g/mol
IUPAC name2,3,5,6-tetradeuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]benzoic acid
InChIKeyKDVYCTOWXSLNNI-JPLVHWSDSA-N
SMILES[2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H]

Computed by PubChem (NCBI)