CAS 2733271-85-5 is the registry number for 4-tert-Butylbenzoic-d13 Acid, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,25g, 0,1g.
2,3,5,6-tetradeuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]benzoic acid (CAS 2733271-85-5) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 191.31 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]benzoic acid. InChIKey: KDVYCTOWXSLNNI-JPLVHWSDSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 191.31 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]benzoic acid |
| InChIKey | KDVYCTOWXSLNNI-JPLVHWSDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)