CAS 2733385-46-9 is the registry number for H-L-Dap(Z)-OtBu*HCl. Offered by: Iris Biotech. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl (2S)-2-amino-3-(phenylmethoxycarbonylamino)propanoate;hydrochloride (CAS 2733385-46-9) is a chemical compound with the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-(phenylmethoxycarbonylamino)propanoate;hydrochloride. InChIKey: FGOCKJILLUDOHD-YDALLXLXSA-N.
| Molecular formula | C15H23ClN2O4 |
|---|---|
| Molecular weight | 330.81 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-(phenylmethoxycarbonylamino)propanoate;hydrochloride |
| InChIKey | FGOCKJILLUDOHD-YDALLXLXSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CNC(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)