Products 2734417-01-5
CAS 2734417-01-5 is the registry number for Terbinafine N-Oxide Hydrochloride. Offered by: Mikromol. Available pack sizes: 100mg.
(E)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine oxide;hydrochloride (CAS 2734417-01-5) is a chemical compound with the molecular formula C21H26ClNO and a molecular weight of 343.9 g/mol. IUPAC name: (E)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine oxide;hydrochloride. InChIKey: FGVVGZTYKQECCJ-SZKNIZGXSA-N.
| Molecular formula | C21H26ClNO |
|---|---|
| Molecular weight | 343.9 g/mol |
| IUPAC name | (E)-N,6,6-trimethyl-N-(naphthalen-1-ylmethyl)hept-2-en-4-yn-1-amine oxide;hydrochloride |
| InChIKey | FGVVGZTYKQECCJ-SZKNIZGXSA-N |
| SMILES | CC(C)(C)C#C/C=C/C[N+](C)(CC1=CC=CC2=CC=CC=C21)[O-].Cl |
Computed by PubChem (NCBI)