Products 2734777-58-1
CAS 2734777-58-1 is the registry number for 6-Chloro-2-fluoro-N-isopropyl-3-methoxybenzamide, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
6-chloro-2-fluoro-3-methoxy-N-propan-2-ylbenzamide (CAS 2734777-58-1) is a chemical compound with the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. IUPAC name: 6-chloro-2-fluoro-3-methoxy-N-propan-2-ylbenzamide. InChIKey: HNOVPFKGAMPPKD-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO2 |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | 6-chloro-2-fluoro-3-methoxy-N-propan-2-ylbenzamide |
| InChIKey | HNOVPFKGAMPPKD-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=C(C=CC(=C1F)OC)Cl |
Computed by PubChem (NCBI)