Products 2734778-98-2
CAS 2734778-98-2 is the registry number for Methyl 3-(4-fluorophenyl)-3-hydroxybutanoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 3-(4-fluorophenyl)-3-hydroxybutanoate (CAS 2734778-98-2) is a chemical compound with the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. IUPAC name: methyl 3-(4-fluorophenyl)-3-hydroxybutanoate. InChIKey: PQFZXWOYWXCICD-UHFFFAOYSA-N.
| Molecular formula | C11H13FO3 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | methyl 3-(4-fluorophenyl)-3-hydroxybutanoate |
| InChIKey | PQFZXWOYWXCICD-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)OC)(C1=CC=C(C=C1)F)O |
Computed by PubChem (NCBI)