Products 2734780-25-5
CAS 2734780-25-5 is the registry number for N'-(4-bromo-3-methylbenzylidene)-4-methylbenzenesulfonohydrazide, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
N-[(E)-(4-bromo-3-methylphenyl)methylideneamino]-4-methylbenzenesulfonamide (CAS 2734780-25-5) is a chemical compound with the molecular formula C15H15BrN2O2S and a molecular weight of 367.3 g/mol. IUPAC name: N-[(E)-(4-bromo-3-methylphenyl)methylideneamino]-4-methylbenzenesulfonamide. InChIKey: LJFISZOLRRQHFB-LICLKQGHSA-N.
| Molecular formula | C15H15BrN2O2S |
|---|---|
| Molecular weight | 367.3 g/mol |
| IUPAC name | N-[(E)-(4-bromo-3-methylphenyl)methylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | LJFISZOLRRQHFB-LICLKQGHSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC(=C(C=C2)Br)C |
Computed by PubChem (NCBI)