CAS 2734844-49-4 is the registry number for Acipimox Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-1,4-dioxidopyrazine-1,4-diium-2-carboxylic acid (CAS 2734844-49-4) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: 5-methyl-1,4-dioxidopyrazine-1,4-diium-2-carboxylic acid. InChIKey: SQTKVXGXVJZOKD-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4 |
|---|---|
| Molecular weight | 170.12 g/mol |
| IUPAC name | 5-methyl-1,4-dioxidopyrazine-1,4-diium-2-carboxylic acid |
| InChIKey | SQTKVXGXVJZOKD-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=C(C=[N+]1[O-])C(=O)O)[O-] |
Computed by PubChem (NCBI)