Products 2734844-49-4

CAS 2734844-49-4 is the registry number for Acipimox Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-methyl-1,4-dioxidopyrazine-1,4-diium-2-carboxylic acid (CAS 2734844-49-4) is a chemical compound with the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. IUPAC name: 5-methyl-1,4-dioxidopyrazine-1,4-diium-2-carboxylic acid. InChIKey: SQTKVXGXVJZOKD-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6N2O4
Molecular weight170.12 g/mol
IUPAC name5-methyl-1,4-dioxidopyrazine-1,4-diium-2-carboxylic acid
InChIKeySQTKVXGXVJZOKD-UHFFFAOYSA-N
SMILESCC1=C[N+](=C(C=[N+]1[O-])C(=O)O)[O-]

Computed by PubChem (NCBI)