Products 2734865-04-2
CAS 2734865-04-2 is the registry number for tert-Butyl (1S,2S)-2-(5-hydroxypentyl)-1-methylcyclopropane-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-tert-butyl (1S,2S)-2-(5-hydroxypentyl)-1-methylcyclopropane-1-carboxylate (CAS 2734865-04-2) is a chemical compound with the molecular formula C14H26O3 and a molecular weight of 242.35 g/mol. IUPAC name: trans-tert-butyl (1S,2S)-2-(5-hydroxypentyl)-1-methylcyclopropane-1-carboxylate. InChIKey: MAVDOYFQFBJMJK-FZMZJTMJSA-N.
| Molecular formula | C14H26O3 |
|---|---|
| Molecular weight | 242.35 g/mol |
| IUPAC name | trans-tert-butyl (1S,2S)-2-(5-hydroxypentyl)-1-methylcyclopropane-1-carboxylate |
| InChIKey | MAVDOYFQFBJMJK-FZMZJTMJSA-N |
| SMILES | C[C@@]1(C[C@@H]1CCCCCO)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)