Products 37826-52-1

CAS 37826-52-1 is the registry number for Decyl 3-oxobutanoate 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Decyl 3-oxobutanoate (CAS 37826-52-1) is a chemical compound with the molecular formula C14H26O3 and a molecular weight of 242.35 g/mol. IUPAC name: decyl 3-oxobutanoate. InChIKey: CLCYRHCSVWOLHG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H26O3
Molecular weight242.35 g/mol
IUPAC namedecyl 3-oxobutanoate
InChIKeyCLCYRHCSVWOLHG-UHFFFAOYSA-N
SMILESCCCCCCCCCCOC(=O)CC(=O)C

Computed by PubChem (NCBI)