CAS 943858-34-2 is the registry number for (2S,4E,6R,8S)-8-Hydroxy-2,4,6-trimethyl-4-nonenoic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 1mg, 5mg.
Ethyl (E,2S,6R,8S)-8-hydroxy-2,4,6-trimethylnon-4-enoate (CAS 943858-34-2) is a chemical compound with the molecular formula C14H26O3 and a molecular weight of 242.35 g/mol. IUPAC name: ethyl (E,2S,6R,8S)-8-hydroxy-2,4,6-trimethylnon-4-enoate. InChIKey: ZHCKMPFULIYWCN-UINPNPHTSA-N.
| Molecular formula | C14H26O3 |
|---|---|
| Molecular weight | 242.35 g/mol |
| IUPAC name | ethyl (E,2S,6R,8S)-8-hydroxy-2,4,6-trimethylnon-4-enoate |
| InChIKey | ZHCKMPFULIYWCN-UINPNPHTSA-N |
| SMILES | CCOC(=O)[C@@H](C)C/C(=C/[C@H](C)C[C@H](C)O)/C |
Computed by PubChem (NCBI)