Products 2735653-65-1

CAS 2735653-65-1 is the registry number for 2-(2-Methoxyethyl)-2H-1,2,3-triazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(2-methoxyethyl)triazole-4-carboxylic acid (CAS 2735653-65-1) is a chemical compound with the molecular formula C6H9N3O3 and a molecular weight of 171.15 g/mol. IUPAC name: 2-(2-methoxyethyl)triazole-4-carboxylic acid. InChIKey: PWJSEGDXNNVHQT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9N3O3
Molecular weight171.15 g/mol
IUPAC name2-(2-methoxyethyl)triazole-4-carboxylic acid
InChIKeyPWJSEGDXNNVHQT-UHFFFAOYSA-N
SMILESCOCCN1N=CC(=N1)C(=O)O

Computed by PubChem (NCBI)