CAS 2735699-15-5 is the registry number for 6'-Bromo-4'-fluorospiro[cyclopropane-1,3'-indolin]-2'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one (CAS 2735699-15-5) is a chemical compound with the molecular formula C10H7BrFNO and a molecular weight of 256.07 g/mol. IUPAC name: 6-bromo-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one. InChIKey: UZGNDNYNFALROA-UHFFFAOYSA-N.
| Molecular formula | C10H7BrFNO |
|---|---|
| Molecular weight | 256.07 g/mol |
| IUPAC name | 6-bromo-4-fluorospiro[1H-indole-3,1'-cyclopropane]-2-one |
| InChIKey | UZGNDNYNFALROA-UHFFFAOYSA-N |
| SMILES | C1CC12C3=C(C=C(C=C3F)Br)NC2=O |
Computed by PubChem (NCBI)