Products 2736397-42-3
CAS 2736397-42-3 is the registry number for 2-[[3-(Ethylsulfonyl)-2-pyridinyl]amino]-6-methoxy-4(3H)-pyrimidinone, 95%, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg.
2-[(3-ethylsulfonyl-2-pyridinyl)amino]-4-methoxy-1H-pyrimidin-6-one (CAS 2736397-42-3) is a chemical compound with the molecular formula C12H14N4O4S and a molecular weight of 310.33 g/mol. IUPAC name: 2-[(3-ethylsulfonyl-2-pyridinyl)amino]-4-methoxy-1H-pyrimidin-6-one. InChIKey: ALBJPZLTGKBZLV-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O4S |
|---|---|
| Molecular weight | 310.33 g/mol |
| IUPAC name | 2-[(3-ethylsulfonyl-2-pyridinyl)amino]-4-methoxy-1H-pyrimidin-6-one |
| InChIKey | ALBJPZLTGKBZLV-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(N=CC=C1)NC2=NC(=CC(=O)N2)OC |
Computed by PubChem (NCBI)