Products 1330266-05-1
CAS 1330266-05-1 appears in our catalog under these names: Sulfadoxin–d4, Sulfadoxine-d4 (benzene-d4), 98 atom % D, min 98% Chemical Purity, Sulfadoxine-d4, Sulfadoxine-d4, 98.0%. Offered by: GLPBio, CDN, TRC, MedChemExpress. Available pack sizes: 1mg, 0,01g, 0,005g, 10mg, 1 mg.
4-amino-2,3,5,6-tetradeuterio-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide (CAS 1330266-05-1) is a chemical compound with the molecular formula C12H14N4O4S and a molecular weight of 314.36 g/mol. IUPAC name: 4-amino-2,3,5,6-tetradeuterio-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide. InChIKey: PJSFRIWCGOHTNF-LNFUJOGGSA-N.
| Molecular formula | C12H14N4O4S |
|---|---|
| Molecular weight | 314.36 g/mol |
| IUPAC name | 4-amino-2,3,5,6-tetradeuterio-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide |
| InChIKey | PJSFRIWCGOHTNF-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)NC2=C(C(=NC=N2)OC)OC)[2H] |
Computed by PubChem (NCBI)