Products 1334378-48-1
CAS 1334378-48-1 appears in our catalog under these names: Sulfadimethoxine 13C6 (phenyl 13C6), Sulfadimethoxine-13C6, 13C6-Sulfadimethoxine, ISO 17034 RM, 13C6-Sulfadimethoxine, 100 µg/ml in Acetonitrile, ISO 17034 CRM. Offered by: Dr. Ehrenstorfer, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 5mg, 1mg, 1ml.
4-amino-N-(2,6-dimethoxypyrimidin-4-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide (CAS 1334378-48-1) is a chemical compound with the molecular formula C12H14N4O4S and a molecular weight of 316.29 g/mol. IUPAC name: 4-amino-N-(2,6-dimethoxypyrimidin-4-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide. InChIKey: ZZORFUFYDOWNEF-CICUYXHZSA-N.
| Molecular formula | C12H14N4O4S |
|---|---|
| Molecular weight | 316.29 g/mol |
| IUPAC name | 4-amino-N-(2,6-dimethoxypyrimidin-4-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide |
| InChIKey | ZZORFUFYDOWNEF-CICUYXHZSA-N |
| SMILES | COC1=NC(=NC(=C1)NS(=O)(=O)[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)N)OC |
Computed by PubChem (NCBI)