CAS 1020719-80-5 appears in our catalog under these names: Sulfadimethoxine-D4, Sulfadimethoxine-d4, >95% (HPLC), Sulfadimethoxine D4, Sulfadimethoxine-d4, 98.0%, D4-Sulfadimethoxine. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 1 mg, 1x5mg, 1x1ml.
4-amino-2,3,5,6-tetradeuterio-N-(2,6-dimethoxypyrimidin-4-yl)benzenesulfonamide (CAS 1020719-80-5) is a chemical compound with the molecular formula C12H14N4O4S and a molecular weight of 314.36 g/mol. IUPAC name: 4-amino-2,3,5,6-tetradeuterio-N-(2,6-dimethoxypyrimidin-4-yl)benzenesulfonamide. InChIKey: ZZORFUFYDOWNEF-LNFUJOGGSA-N.
| Molecular formula | C12H14N4O4S |
|---|---|
| Molecular weight | 314.36 g/mol |
| IUPAC name | 4-amino-2,3,5,6-tetradeuterio-N-(2,6-dimethoxypyrimidin-4-yl)benzenesulfonamide |
| InChIKey | ZZORFUFYDOWNEF-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)NC2=CC(=NC(=N2)OC)OC)[2H] |
Computed by PubChem (NCBI)