Products 2738376-67-3
CAS 2738376-67-3 is the registry number for Etifoxine–13C–d3. Offered by: GLPBio. Available pack sizes: 1mg, 500μg.
6-chloro-N-ethyl-4-phenyl-4-(trideuterio(113C)methyl)-1H-3,1-benzoxazin-2-imine (CAS 2738376-67-3) is a chemical compound with the molecular formula C17H17ClN2O and a molecular weight of 304.79 g/mol. IUPAC name: 6-chloro-N-ethyl-4-phenyl-4-(trideuterio(113C)methyl)-1H-3,1-benzoxazin-2-imine. InChIKey: IBYCYJFUEJQSMK-JVXUGDAPSA-N.
| Molecular formula | C17H17ClN2O |
|---|---|
| Molecular weight | 304.79 g/mol |
| IUPAC name | 6-chloro-N-ethyl-4-phenyl-4-(trideuterio(113C)methyl)-1H-3,1-benzoxazin-2-imine |
| InChIKey | IBYCYJFUEJQSMK-JVXUGDAPSA-N |
| SMILES | [2H][13C]([2H])([2H])C1(C2=C(C=CC(=C2)Cl)NC(=NCC)O1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
Etifoxine-13C-d3, Etifoxine-13C,d3