CAS 2738583-25-8 appears in our catalog under these names: Enpp–1–IN–19, Enpp-1-IN-19, 99.28%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 100 mg, 10 mg, 10mM/1mL, 5 mg, 25 mg.
2-methyl-1-oxo-4-[[4-(sulfamoylamino)phenyl]methyl]phthalazine (CAS 2738583-25-8) is a chemical compound with the molecular formula C16H16N4O3S and a molecular weight of 344.4 g/mol. IUPAC name: 2-methyl-1-oxo-4-[[4-(sulfamoylamino)phenyl]methyl]phthalazine. InChIKey: ZBMUKGSKMVACJQ-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O3S |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | 2-methyl-1-oxo-4-[[4-(sulfamoylamino)phenyl]methyl]phthalazine |
| InChIKey | ZBMUKGSKMVACJQ-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=CC=CC=C2C(=N1)CC3=CC=C(C=C3)NS(=O)(=O)N |
Computed by PubChem (NCBI)