CAS 27392-17-2 is the registry number for rac-(1R,3S)-3-tert-Butylcyclohexane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Cis-(1S,3R)-3-tert-butylcyclohexane-1-carboxylic acid (CAS 27392-17-2) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: cis-(1S,3R)-3-tert-butylcyclohexane-1-carboxylic acid. InChIKey: LIBHBDGDJPRTOA-DTWKUNHWSA-N.
| Molecular formula | C11H20O2 |
|---|---|
| Molecular weight | 184.27 g/mol |
| IUPAC name | cis-(1S,3R)-3-tert-butylcyclohexane-1-carboxylic acid |
| InChIKey | LIBHBDGDJPRTOA-DTWKUNHWSA-N |
| SMILES | CC(C)(C)[C@@H]1CCC[C@@H](C1)C(=O)O |
Computed by PubChem (NCBI)