CAS 2740385-19-5 is the registry number for 5-Hydroxypyrazinecarboxamide-13C3. Offered by: TRC. Available pack sizes: 25mg.
6-oxo-(2,3-13C2)1H-pyrazine-3-carboxamide (CAS 2740385-19-5) is a chemical compound with the molecular formula C5H5N3O2 and a molecular weight of 142.09 g/mol. IUPAC name: 6-oxo-(2,3-13C2)1H-pyrazine-3-carboxamide. InChIKey: XENWQEOTDAQROM-CGANOEODSA-N.
| Molecular formula | C5H5N3O2 |
|---|---|
| Molecular weight | 142.09 g/mol |
| IUPAC name | 6-oxo-(2,3-13C2)1H-pyrazine-3-carboxamide |
| InChIKey | XENWQEOTDAQROM-CGANOEODSA-N |
| SMILES | C1=N[13C](=[13CH]NC1=O)[13C](=O)N |
Computed by PubChem (NCBI)