CAS 2740592-88-3 is the registry number for (1R,2S)-2-((Benzyloxy)methyl)cyclobutan-1-ol, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Cis-(1R,2S)-2-(phenylmethoxymethyl)cyclobutan-1-ol (CAS 2740592-88-3) is a chemical compound with the molecular formula C12H16O2 and a molecular weight of 192.25 g/mol. IUPAC name: cis-(1R,2S)-2-(phenylmethoxymethyl)cyclobutan-1-ol. InChIKey: UVPHYUXOZOKSCJ-NWDGAFQWSA-N.
| Molecular formula | C12H16O2 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | cis-(1R,2S)-2-(phenylmethoxymethyl)cyclobutan-1-ol |
| InChIKey | UVPHYUXOZOKSCJ-NWDGAFQWSA-N |
| SMILES | C1C[C@H]([C@@H]1COCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)