CAS 2741620-16-4 is the registry number for 4-Amino-2,6-dichloro-3-pyridinecarbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-amino-2,6-dichloropyridine-3-carbonitrile (CAS 2741620-16-4) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 4-amino-2,6-dichloropyridine-3-carbonitrile. InChIKey: QJHWOTXPTCHUFE-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 4-amino-2,6-dichloropyridine-3-carbonitrile |
| InChIKey | QJHWOTXPTCHUFE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)C#N)N |
Computed by PubChem (NCBI)