CAS 2744300-63-6 is the registry number for MO-2097. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(7-methyl-5,8-dihydrofuro[3,2-h][1]benzoxepin-2-yl)benzene-1,3-diol (CAS 2744300-63-6) is a chemical compound with the molecular formula C19H16O4 and a molecular weight of 308.3 g/mol. IUPAC name: 5-(7-methyl-5,8-dihydrofuro[3,2-h][1]benzoxepin-2-yl)benzene-1,3-diol. InChIKey: FNKVYUANMNGOPU-UHFFFAOYSA-N.
| Molecular formula | C19H16O4 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | 5-(7-methyl-5,8-dihydrofuro[3,2-h][1]benzoxepin-2-yl)benzene-1,3-diol |
| InChIKey | FNKVYUANMNGOPU-UHFFFAOYSA-N |
| SMILES | CC1=CCC2=C(C=C3C(=C2)C=C(O3)C4=CC(=CC(=C4)O)O)OC1 |
Computed by PubChem (NCBI)