CAS 2747-08-2 is the registry number for 2-Bromo-5,6-dimethoxy-2,3-dihydro-1H-inden-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
2-bromo-5,6-dimethoxy-2,3-dihydroinden-1-one (CAS 2747-08-2) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: 2-bromo-5,6-dimethoxy-2,3-dihydroinden-1-one. InChIKey: NSPWDODUFKPVMO-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | 2-bromo-5,6-dimethoxy-2,3-dihydroinden-1-one |
| InChIKey | NSPWDODUFKPVMO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CC(C2=O)Br)OC |
Computed by PubChem (NCBI)