Products 2748247-26-7
CAS 2748247-26-7 appears in our catalog under these names: Chlorambucil-d8 (bis(2-chloroethyl-d4)), 99 atom % D, min 98% Chemical Purity, Chlorambucil–d8. Offered by: CDN, GLPBio. Available pack sizes: 0,01g, 0,005g, 1mg, 500μg.
4-[4-[bis(2-chloro-1,1,2,2-tetradeuterioethyl)amino]phenyl]butanoic acid (CAS 2748247-26-7) is a chemical compound with the molecular formula C14H19Cl2NO2 and a molecular weight of 312.3 g/mol. IUPAC name: 4-[4-[bis(2-chloro-1,1,2,2-tetradeuterioethyl)amino]phenyl]butanoic acid. InChIKey: JCKYGMPEJWAADB-JNJBWJDISA-N.
| Molecular formula | C14H19Cl2NO2 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 4-[4-[bis(2-chloro-1,1,2,2-tetradeuterioethyl)amino]phenyl]butanoic acid |
| InChIKey | JCKYGMPEJWAADB-JNJBWJDISA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])Cl)N(C1=CC=C(C=C1)CCCC(=O)O)C([2H])([2H])C([2H])([2H])Cl |
Computed by PubChem (NCBI)