Products 2748453-60-1

CAS 2748453-60-1 is the registry number for 2-Bromo-3,5-difluoro-4-pyridinecarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-bromo-3,5-difluoropyridine-4-carboxylic acid (CAS 2748453-60-1) is a chemical compound with the molecular formula C6H2BrF2NO2 and a molecular weight of 237.99 g/mol. IUPAC name: 2-bromo-3,5-difluoropyridine-4-carboxylic acid. InChIKey: IMPJHGLWTVDYSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H2BrF2NO2
Molecular weight237.99 g/mol
IUPAC name2-bromo-3,5-difluoropyridine-4-carboxylic acid
InChIKeyIMPJHGLWTVDYSQ-UHFFFAOYSA-N
SMILESC1=C(C(=C(C(=N1)Br)F)C(=O)O)F

Computed by PubChem (NCBI)