Products 2748469-51-2
CAS 2748469-51-2 is the registry number for RCS–4 N–pentanoic acid metabolite–d5. Offered by: GLPBio. Available pack sizes: 1mg, 100μg, 500μg.
5-[2,4,5,6,7-pentadeuterio-3-(4-methoxybenzoyl)indol-1-yl]pentanoic acid (CAS 2748469-51-2) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 356.4 g/mol. IUPAC name: 5-[2,4,5,6,7-pentadeuterio-3-(4-methoxybenzoyl)indol-1-yl]pentanoic acid. InChIKey: CJXFWFGLGOBGBR-RYNKYBBCSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 5-[2,4,5,6,7-pentadeuterio-3-(4-methoxybenzoyl)indol-1-yl]pentanoic acid |
| InChIKey | CJXFWFGLGOBGBR-RYNKYBBCSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCC(=O)O)[2H])C(=O)C3=CC=C(C=C3)OC)[2H])[2H] |
Computed by PubChem (NCBI)