CAS 2749302-38-1 is the registry number for 3–methyl–α–Pyrrolidinopropiophenone (hydrochloride). Offered by: GLPBio. Available pack sizes: 10mg, 5mg, 50mg.
1-(3-methylphenyl)-2-pyrrolidin-1-ylpropan-1-one;hydrochloride (CAS 2749302-38-1) is a chemical compound with the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. IUPAC name: 1-(3-methylphenyl)-2-pyrrolidin-1-ylpropan-1-one;hydrochloride. InChIKey: DRPHGPKMCWBJAA-UHFFFAOYSA-N.
| Molecular formula | C14H20ClNO |
|---|---|
| Molecular weight | 253.77 g/mol |
| IUPAC name | 1-(3-methylphenyl)-2-pyrrolidin-1-ylpropan-1-one;hydrochloride |
| InChIKey | DRPHGPKMCWBJAA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)C(C)N2CCCC2.Cl |
Computed by PubChem (NCBI)