Products 2749303-12-4
CAS 2749303-12-4 appears in our catalog under these names: 3',4'–Methylenedioxy–N,N–diethylcathinone (hydrochloride), 1-(1,3-Benzodioxol-5-yl)-2-(diethylamino)-1-propanone (hydrochloride). Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 50mg, 10 mg, 5 mg, 50 mg, 25 mg.
1-(1,3-benzodioxol-5-yl)-2-(diethylamino)propan-1-one;hydrochloride (CAS 2749303-12-4) is a chemical compound with the molecular formula C14H20ClNO3 and a molecular weight of 285.76 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-(diethylamino)propan-1-one;hydrochloride. InChIKey: QQZLDTFMAHLJAC-UHFFFAOYSA-N.
| Molecular formula | C14H20ClNO3 |
|---|---|
| Molecular weight | 285.76 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-(diethylamino)propan-1-one;hydrochloride |
| InChIKey | QQZLDTFMAHLJAC-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(C)C(=O)C1=CC2=C(C=C1)OCO2.Cl |
Computed by PubChem (NCBI)