CAS 2749504-06-9 appears in our catalog under these names: 2,3-Ethylone Isomer Hydrochloride, 2,3–Methylenedioxy–α–ethylaminopropiophenone (hydrochloride). Offered by: TRC, GLPBio. Available pack sizes: 250mg, 1mg, 10mg, 5mg.
1-(1,3-benzodioxol-4-yl)-2-(ethylamino)propan-1-one;hydrochloride (CAS 2749504-06-9) is a chemical compound with the molecular formula C12H16ClNO3 and a molecular weight of 257.71 g/mol. IUPAC name: 1-(1,3-benzodioxol-4-yl)-2-(ethylamino)propan-1-one;hydrochloride. InChIKey: NBKLIAKMVVIVEL-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO3 |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-4-yl)-2-(ethylamino)propan-1-one;hydrochloride |
| InChIKey | NBKLIAKMVVIVEL-UHFFFAOYSA-N |
| SMILES | CCNC(C)C(=O)C1=C2C(=CC=C1)OCO2.Cl |
Computed by PubChem (NCBI)