CAS 2750-20-1 appears in our catalog under these names: 3-Benzyl-4-methoxyaniline hydrochloride, 95%, 3-Benzyl-4-methoxyaniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-benzyl-4-methoxyaniline;hydrochloride (CAS 2750-20-1) is a chemical compound with the molecular formula C14H16ClNO and a molecular weight of 249.73 g/mol. IUPAC name: 3-benzyl-4-methoxyaniline;hydrochloride. InChIKey: HKJHOFAGRSMFLC-UHFFFAOYSA-N.
| Molecular formula | C14H16ClNO |
|---|---|
| Molecular weight | 249.73 g/mol |
| IUPAC name | 3-benzyl-4-methoxyaniline;hydrochloride |
| InChIKey | HKJHOFAGRSMFLC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)