Products 2750617-51-5
CAS 2750617-51-5 is the registry number for tert-Butyl (S)-7-chloro-2-methyl-2,3-dihydro-1H-pyrido[2,3-b][1,4]oxazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2S)-7-chloro-2-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate (CAS 2750617-51-5) is a chemical compound with the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. IUPAC name: tert-butyl (2S)-7-chloro-2-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate. InChIKey: IABAXPWARQGQOG-QMMMGPOBSA-N.
| Molecular formula | C13H17ClN2O3 |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | tert-butyl (2S)-7-chloro-2-methyl-2,3-dihydropyrido[2,3-b][1,4]oxazine-1-carboxylate |
| InChIKey | IABAXPWARQGQOG-QMMMGPOBSA-N |
| SMILES | C[C@H]1COC2=C(N1C(=O)OC(C)(C)C)C=C(C=N2)Cl |
Computed by PubChem (NCBI)