CAS 1252018-21-5 is the registry number for Rivaroxaban Impurity 112. Offered by: Chemat Brand. Available pack sizes: on request.
4-[4-[[(2S)-3-chloro-2-hydroxypropyl]amino]phenyl]morpholin-3-one (CAS 1252018-21-5) is a chemical compound with the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. IUPAC name: 4-[4-[[(2S)-3-chloro-2-hydroxypropyl]amino]phenyl]morpholin-3-one. InChIKey: NPRLIANVFKCHMG-GFCCVEGCSA-N.
| Molecular formula | C13H17ClN2O3 |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | 4-[4-[[(2S)-3-chloro-2-hydroxypropyl]amino]phenyl]morpholin-3-one |
| InChIKey | NPRLIANVFKCHMG-GFCCVEGCSA-N |
| SMILES | C1COCC(=O)N1C2=CC=C(C=C2)NC[C@@H](CCl)O |
Computed by PubChem (NCBI)