Products 1260684-49-8

CAS 1260684-49-8 is the registry number for Methyl 4-(pyrrolidine-2-carboxamido)benzoate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4-(pyrrolidine-2-carbonylamino)benzoate;hydrochloride (CAS 1260684-49-8) is a chemical compound with the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. IUPAC name: methyl 4-(pyrrolidine-2-carbonylamino)benzoate;hydrochloride. InChIKey: ZDCLJJSNJHEAOA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17ClN2O3
Molecular weight284.74 g/mol
IUPAC namemethyl 4-(pyrrolidine-2-carbonylamino)benzoate;hydrochloride
InChIKeyZDCLJJSNJHEAOA-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)NC(=O)C2CCCN2.Cl

Computed by PubChem (NCBI)