CAS 70918-74-0 appears in our catalog under these names: Doxazosin EP Impurity B HCl (Doxazosin USP Related Compound A), 1-((2,3-Dihydro-1,4-benzodioxin-2-yl)carbonyl)piperazine Monohydrochloride, >95% (HPLC), 1-((2RS)-2,3-Dihydro-1,4-benzodioxin-2-ylcarbonyl)piperazine Hydrochloride, 2–(1–Piperazinylcarbonyl)–1,4–benzodioxane Hydrochloride, N-(1,4-Benzodioxan-2-carbonyl)-piperazine hydrochloride. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 1g, 25g, 5g, 25mg, 100mg, 100g, 10g.
2,3-dihydro-1,4-benzodioxin-3-yl(piperazin-1-yl)methanone;hydrochloride (CAS 70918-74-0) is a chemical compound with the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxin-3-yl(piperazin-1-yl)methanone;hydrochloride. InChIKey: TUKBWYXLYINULI-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O3 |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxin-3-yl(piperazin-1-yl)methanone;hydrochloride |
| InChIKey | TUKBWYXLYINULI-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)C2COC3=CC=CC=C3O2.Cl |
Computed by PubChem (NCBI)