Products 2752242-49-0
CAS 2752242-49-0 is the registry number for (S)-N-Boc-2,2-difluorocyclopropanamine, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(1S)-2,2-difluorocyclopropyl]carbamate (CAS 2752242-49-0) is a chemical compound with the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. IUPAC name: tert-butyl N-[(1S)-2,2-difluorocyclopropyl]carbamate. InChIKey: NZWXSCJTYUJHFF-YFKPBYRVSA-N.
| Molecular formula | C8H13F2NO2 |
|---|---|
| Molecular weight | 193.19 g/mol |
| IUPAC name | tert-butyl N-[(1S)-2,2-difluorocyclopropyl]carbamate |
| InChIKey | NZWXSCJTYUJHFF-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC1(F)F |
Computed by PubChem (NCBI)
Synonyms:
(S)-N-Boc-2,2-difluorocyclopropanamine