CAS 27533-32-0 appears in our catalog under these names: 3–Amino–2–naphthamide, 3-Amino-2-naphthamide 95%, 3-Amino-2-naphthamide, 95%, 95%, 3-Amino-2-naphthamide, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-aminonaphthalene-2-carboxamide (CAS 27533-32-0) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 3-aminonaphthalene-2-carboxamide. InChIKey: FAHCDVQMLWBDSF-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 3-aminonaphthalene-2-carboxamide |
| InChIKey | FAHCDVQMLWBDSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)N)N |
Computed by PubChem (NCBI)