CAS 27542-41-2 appears in our catalog under these names: 4-Chloro-D-tryptophan, 96%, 4-Chloro-D-tryptophan, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
(2R)-2-amino-3-(4-chloro-1H-indol-3-yl)propanoic acid (CAS 27542-41-2) is a chemical compound with the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. IUPAC name: (2R)-2-amino-3-(4-chloro-1H-indol-3-yl)propanoic acid. InChIKey: NRTHKYABOMUPSC-MRVPVSSYSA-N.
| Molecular formula | C11H11ClN2O2 |
|---|---|
| Molecular weight | 238.67 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-chloro-1H-indol-3-yl)propanoic acid |
| InChIKey | NRTHKYABOMUPSC-MRVPVSSYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=CN2)C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)